C21H25N5O4 — CID 123901204
[2,2-dimethyl-4-[4-[(3-methylphenyl)methylamino]imidazo[2,1-f][1,2,4]triazin-7-yl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methanol (PubChem CID 123901204) has the molecular formula C21H25N5O4 and a molecular weight of 411.46 g/mol. Its IUPAC name is [2,2-dimethyl-4-[4-[(3-methylphenyl)methylamino]imidazo[2,1-f][1,2,4]triazin-7-yl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methanol.
| Compound Name | [2,2-dimethyl-4-[4-[(3-methylphenyl)methylamino]imidazo[2,1-f][1,2,4]triazin-7-yl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methanol |
|---|---|
| PubChem CID | 123901204 |
| Molecular Formula | C21H25N5O4 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.19 |
| IUPAC Name | [2,2-dimethyl-4-[4-[(3-methylphenyl)methylamino]imidazo[2,1-f][1,2,4]triazin-7-yl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methanol |
| SMILES | Cc1cccc(CNc2ncnn3c(C4OC(CO)C5OC(C)(C)OC45)cnc23)c1 |
| InChI | InChI=1S/C21H25N5O4/c1-12-5-4-6-13(7-12)8-22-19-20-23-9-14(26(20)25-11-24-19)16-18-17(15(10-27)28-16)29-21(2,3)30-18/h4-7,9,11,15-18,27H,8,10H2,1-3H3,(H,22,24,25) |
| InChIKey | FWDIUHYBRGJDTC-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 103.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |