C17H15ClF3NO2 — CID 123901207
2-(6-chloronona-2,4,6-trien-5-yl)-5-(trifluoromethoxy)-1,3-benzoxazole (PubChem CID 123901207) has the molecular formula C17H15ClF3NO2 and a molecular weight of 357.76 g/mol. Its IUPAC name is 2-(6-chloronona-2,4,6-trien-5-yl)-5-(trifluoromethoxy)-1,3-benzoxazole.
| Compound Name | 2-(6-chloronona-2,4,6-trien-5-yl)-5-(trifluoromethoxy)-1,3-benzoxazole |
|---|---|
| PubChem CID | 123901207 |
| Molecular Formula | C17H15ClF3NO2 |
| Molecular Weight | 357.76 g/mol |
| Exact Mass | 357.07 |
| IUPAC Name | 2-(6-chloronona-2,4,6-trien-5-yl)-5-(trifluoromethoxy)-1,3-benzoxazole |
| SMILES | CC=CC=C(C(Cl)=CCC)c1nc2cc(OC(F)(F)F)ccc2o1 |
| InChI | InChI=1S/C17H15ClF3NO2/c1-3-5-7-12(13(18)6-4-2)16-22-14-10-11(24-17(19,20)21)8-9-15(14)23-16/h3,5-10H,4H2,1-2H3 |
| InChIKey | BJSKAYPAPSIASL-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.76 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|