C17H22N2O3S — CID 123901267
propan-2-yl 6-(4-ethoxyphenyl)-4-methyl-2-sulfanylidene-5,6-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 123901267) has the molecular formula C17H22N2O3S and a molecular weight of 334.44 g/mol. Its IUPAC name is propan-2-yl 6-(4-ethoxyphenyl)-4-methyl-2-sulfanylidene-5,6-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | propan-2-yl 6-(4-ethoxyphenyl)-4-methyl-2-sulfanylidene-5,6-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 123901267 |
| Molecular Formula | C17H22N2O3S |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | propan-2-yl 6-(4-ethoxyphenyl)-4-methyl-2-sulfanylidene-5,6-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | CCOc1ccc(C2NC(=S)N=C(C)C2C(=O)OC(C)C)cc1 |
| InChI | InChI=1S/C17H22N2O3S/c1-5-21-13-8-6-12(7-9-13)15-14(16(20)22-10(2)3)11(4)18-17(23)19-15/h6-10,14-15H,5H2,1-4H3,(H,19,23) |
| InChIKey | PLKGCBMNPMVJDY-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|