C26H29Cl2N3O2 — CID 123901490
(3R,3aS,4S,5R,7aR)-5-[2-chloro-4-(5-methyl-2,3-dihydro-1,3,4-oxadiazol-2-yl)phenyl]-4-(4-chlorophenyl)-7a-ethyl-3-methyl-3,3a,4,5,6,7-hexahydro-2H-isoindol-1-one (PubChem CID 123901490) has the molecular formula C26H29Cl2N3O2 and a molecular weight of 486.44 g/mol. Its IUPAC name is (3R,3aS,4S,5R,7aR)-5-[2-chloro-4-(5-methyl-2,3-dihydro-1,3,4-oxadiazol-2-yl)phenyl]-4-(4-chlorophenyl)-7a-ethyl-3-methyl-3,3a,4,5,6,7-hexahydro-2H-isoindol-1-one.
| Compound Name | (3R,3aS,4S,5R,7aR)-5-[2-chloro-4-(5-methyl-2,3-dihydro-1,3,4-oxadiazol-2-yl)phenyl]-4-(4-chlorophenyl)-7a-ethyl-3-methyl-3,3a,4,5,6,7-hexahydro-2H-isoindol-1-one |
|---|---|
| PubChem CID | 123901490 |
| Molecular Formula | C26H29Cl2N3O2 |
| Molecular Weight | 486.44 g/mol |
| Exact Mass | 485.16 |
| IUPAC Name | (3R,3aS,4S,5R,7aR)-5-[2-chloro-4-(5-methyl-2,3-dihydro-1,3,4-oxadiazol-2-yl)phenyl]-4-(4-chlorophenyl)-7a-ethyl-3-methyl-3,3a,4,5,6,7-hexahydro-2H-isoindol-1-one |
| SMILES | CC[C@@]12CC[C@@H](c3ccc(C4NN=C(C)O4)cc3Cl)[C@H](c3ccc(Cl)cc3)[C@@H]1[C@@H](C)NC2=O |
| InChI | InChI=1S/C26H29Cl2N3O2/c1-4-26-12-11-20(19-10-7-17(13-21(19)28)24-31-30-15(3)33-24)22(16-5-8-18(27)9-6-16)23(26)14(2)29-25(26)32/h5-10,13-14,20,22-24,31H,4,11-12H2,1-3H3,(H,29,32)/t14-,20+,22+,23+,24?,26-/m1/s1 |
| InChIKey | NKODWGFACOFOFZ-IQXMVJIFSA-N |
| XLogP | 6.14 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.44 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |