C56H46Si2 — CID 123901626
[4-[10-[4-[dimethyl(naphthalen-1-yl)silyl]phenyl]-2-phenylanthracen-9-yl]phenyl]-dimethyl-naphthalen-2-ylsilane (PubChem CID 123901626) has the molecular formula C56H46Si2 and a molecular weight of 775.16 g/mol. Its IUPAC name is [4-[10-[4-[dimethyl(naphthalen-1-yl)silyl]phenyl]-2-phenylanthracen-9-yl]phenyl]-dimethyl-naphthalen-2-ylsilane.
| Compound Name | [4-[10-[4-[dimethyl(naphthalen-1-yl)silyl]phenyl]-2-phenylanthracen-9-yl]phenyl]-dimethyl-naphthalen-2-ylsilane |
|---|---|
| PubChem CID | 123901626 |
| Molecular Formula | C56H46Si2 |
| Molecular Weight | 775.16 g/mol |
| Exact Mass | 774.31 |
| IUPAC Name | [4-[10-[4-[dimethyl(naphthalen-1-yl)silyl]phenyl]-2-phenylanthracen-9-yl]phenyl]-dimethyl-naphthalen-2-ylsilane |
| SMILES | C[Si](C)(c1ccc(-c2c3ccccc3c(-c3ccc([Si](C)(C)c4cccc5ccccc45)cc3)c3ccc(-c4ccccc4)cc23)cc1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C56H46Si2/c1-57(2,48-35-25-40-17-8-9-19-44(40)37-48)46-31-26-43(27-32-46)56-51-23-13-12-22-50(51)55(52-36-30-45(38-53(52)56)39-15-6-5-7-16-39)42-28-33-47(34-29-42)58(3,4)54-24-14-20-41-18-10-11-21-49(41)54/h5-38H,1-4H3 |
| InChIKey | BNPVXJDXEXTFQQ-UHFFFAOYSA-N |
| XLogP | 12.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 775.16 |
| LogP ≤ 5 | 12.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|