C20H11F5N2 — CID 123901875
5-[4-(1,2-difluorobuta-1,3-dienyl)phenyl]-2-(3,4,5-trifluorophenyl)pyrimidine (PubChem CID 123901875) has the molecular formula C20H11F5N2 and a molecular weight of 374.31 g/mol. Its IUPAC name is 5-[4-(1,2-difluorobuta-1,3-dienyl)phenyl]-2-(3,4,5-trifluorophenyl)pyrimidine.
| Compound Name | 5-[4-(1,2-difluorobuta-1,3-dienyl)phenyl]-2-(3,4,5-trifluorophenyl)pyrimidine |
|---|---|
| PubChem CID | 123901875 |
| Molecular Formula | C20H11F5N2 |
| Molecular Weight | 374.31 g/mol |
| Exact Mass | 374.08 |
| IUPAC Name | 5-[4-(1,2-difluorobuta-1,3-dienyl)phenyl]-2-(3,4,5-trifluorophenyl)pyrimidine |
| SMILES | C=CC(F)=C(F)c1ccc(-c2cnc(-c3cc(F)c(F)c(F)c3)nc2)cc1 |
| InChI | InChI=1S/C20H11F5N2/c1-2-15(21)18(24)12-5-3-11(4-6-12)14-9-26-20(27-10-14)13-7-16(22)19(25)17(23)8-13/h2-10H,1H2 |
| InChIKey | PRFDKEQABZUEDK-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.31 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|