C37H44N6O7 — CID 123902091
3',6'-bis(diethylamino)-2-[[1-[(3,4,5,6-tetrahydroxyoxan-2-yl)methyl]triazol-4-yl]methyl]spiro[isoindole-3,9'-xanthene]-1-one (PubChem CID 123902091) has the molecular formula C37H44N6O7 and a molecular weight of 684.79 g/mol. Its IUPAC name is 3',6'-bis(diethylamino)-2-[[1-[(3,4,5,6-tetrahydroxyoxan-2-yl)methyl]triazol-4-yl]methyl]spiro[isoindole-3,9'-xanthene]-1-one.
| Compound Name | 3',6'-bis(diethylamino)-2-[[1-[(3,4,5,6-tetrahydroxyoxan-2-yl)methyl]triazol-4-yl]methyl]spiro[isoindole-3,9'-xanthene]-1-one |
|---|---|
| PubChem CID | 123902091 |
| Molecular Formula | C37H44N6O7 |
| Molecular Weight | 684.79 g/mol |
| Exact Mass | 684.33 |
| IUPAC Name | 3',6'-bis(diethylamino)-2-[[1-[(3,4,5,6-tetrahydroxyoxan-2-yl)methyl]triazol-4-yl]methyl]spiro[isoindole-3,9'-xanthene]-1-one |
| SMILES | CCN(CC)c1ccc2c(c1)Oc1cc(N(CC)CC)ccc1C21c2ccccc2C(=O)N1Cc1cn(CC2OC(O)C(O)C(O)C2O)nn1 |
| InChI | InChI=1S/C37H44N6O7/c1-5-40(6-2)23-13-15-27-29(17-23)49-30-18-24(41(7-3)8-4)14-16-28(30)37(27)26-12-10-9-11-25(26)35(47)43(37)20-22-19-42(39-38-22)21-31-32(44)33(45)34(46)36(48)50-31/h9-19,31-34,36,44-46,48H,5-8,20-21H2,1-4H3 |
| InChIKey | OWVLPIRLUPFXHX-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 156.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.79 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'} |
|---|