C20H30 — CID 123902166
1-pentyl-4-(4-propylcyclohex-2-en-1-yl)benzene (PubChem CID 123902166) has the molecular formula C20H30 and a molecular weight of 270.46 g/mol. Its IUPAC name is 1-pentyl-4-(4-propylcyclohex-2-en-1-yl)benzene.
| Compound Name | 1-pentyl-4-(4-propylcyclohex-2-en-1-yl)benzene |
|---|---|
| PubChem CID | 123902166 |
| Molecular Formula | C20H30 |
| Molecular Weight | 270.46 g/mol |
| Exact Mass | 270.23 |
| IUPAC Name | 1-pentyl-4-(4-propylcyclohex-2-en-1-yl)benzene |
| SMILES | CCCCCc1ccc(C2C=CC(CCC)CC2)cc1 |
| InChI | InChI=1S/C20H30/c1-3-5-6-8-18-11-15-20(16-12-18)19-13-9-17(7-4-2)10-14-19/h9,11-13,15-17,19H,3-8,10,14H2,1-2H3 |
| InChIKey | BUYHHGYZULWQHW-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.46 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|