About methyl 7-[(6-but-2-en-2-yl-3,5-difluoro-2-pyridinyl)amino]bicyclo[3.2.2]nonane-6-carboxylate
methyl 7-[(6-but-2-en-2-yl-3,5-difluoro-2-pyridinyl)amino]bicyclo[3.2.2]nonane-6-carboxylate (PubChem CID 123902389) has the molecular formula C20H26F2N2O2
and a molecular weight of 364.44 g/mol. Its IUPAC name is methyl 7-[(6-but-2-en-2-yl-3,5-difluoro-2-pyridinyl)amino]bicyclo[3.2.2]nonane-6-carboxylate.
Molecular Properties
| Compound Name | methyl 7-[(6-but-2-en-2-yl-3,5-difluoro-2-pyridinyl)amino]bicyclo[3.2.2]nonane-6-carboxylate |
| PubChem CID | 123902389 |
| Molecular Formula | C20H26F2N2O2 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | methyl 7-[(6-but-2-en-2-yl-3,5-difluoro-2-pyridinyl)amino]bicyclo[3.2.2]nonane-6-carboxylate |
| SMILES | CC=C(C)c1nc(NC2C3CCCC(CC3)C2C(=O)OC)c(F)cc1F |
| InChI | InChI=1S/C20H26F2N2O2/c1-4-11(2)17-14(21)10-15(22)19(23-17)24-18-13-7-5-6-12(8-9-13)16(18)20(25)26-3/h4,10,12-13,16,18H,5-9H2,1-3H3,(H,23,24) |
| InChIKey | BUMQBNQCMFCNDU-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 7-[(6-but-2-en-2-yl-3,5-difluoro-2-pyridinyl)amino]bicyclo[3.2.2]nonane-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 7-[(6-but-2-en-2-yl-3,5-difluoro-2-pyridinyl)amino]bicyclo[3.2.2]nonane-6-carboxylate?
The IUPAC name of methyl 7-[(6-but-2-en-2-yl-3,5-difluoro-2-pyridinyl)amino]bicyclo[3.2.2]nonane-6-carboxylate (CID 123902389) is methyl 7-[(6-but-2-en-2-yl-3,5-difluoro-2-pyridinyl)amino]bicyclo[3.2.2]nonane-6-carboxylate.
What is the SMILES notation for methyl 7-[(6-but-2-en-2-yl-3,5-difluoro-2-pyridinyl)amino]bicyclo[3.2.2]nonane-6-carboxylate?
The canonical SMILES for methyl 7-[(6-but-2-en-2-yl-3,5-difluoro-2-pyridinyl)amino]bicyclo[3.2.2]nonane-6-carboxylate is CC=C(C)c1nc(NC2C3CCCC(CC3)C2C(=O)OC)c(F)cc1F.
What is the InChIKey of methyl 7-[(6-but-2-en-2-yl-3,5-difluoro-2-pyridinyl)amino]bicyclo[3.2.2]nonane-6-carboxylate?
The InChIKey is BUMQBNQCMFCNDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H26F2N2O2/c1-4-11(2)17-14(21)10-15(22)19(23-17)24-18-13-7-5-6-12(8-9-13)16(18)20(25)26-3/h4,10,12-13,16,18H,5-9H2,1-3H3,(H,23,24).
What are the key properties of methyl 7-[(6-but-2-en-2-yl-3,5-difluoro-2-pyridinyl)amino]bicyclo[3.2.2]nonane-6-carboxylate?
methyl 7-[(6-but-2-en-2-yl-3,5-difluoro-2-pyridinyl)amino]bicyclo[3.2.2]nonane-6-carboxylate has a molecular weight of 364.44 g/mol, XLogP of 4.56, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 7-[(6-but-2-en-2-yl-3,5-difluoro-2-pyridinyl)amino]bicyclo[3.2.2]nonane-6-carboxylate is sourced from PubChem (CID 123902389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).