C22H23F3N2O3 — CID 123902979
methyl 3-[2-[6-(3,3,3-trifluoropropoxy)-1,2,3,4-tetrahydronaphthalen-1-yl]ethylideneamino]pyridine-4-carboxylate (PubChem CID 123902979) has the molecular formula C22H23F3N2O3 and a molecular weight of 420.43 g/mol. Its IUPAC name is methyl 3-[2-[6-(3,3,3-trifluoropropoxy)-1,2,3,4-tetrahydronaphthalen-1-yl]ethylideneamino]pyridine-4-carboxylate.
| Compound Name | methyl 3-[2-[6-(3,3,3-trifluoropropoxy)-1,2,3,4-tetrahydronaphthalen-1-yl]ethylideneamino]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 123902979 |
| Molecular Formula | C22H23F3N2O3 |
| Molecular Weight | 420.43 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | methyl 3-[2-[6-(3,3,3-trifluoropropoxy)-1,2,3,4-tetrahydronaphthalen-1-yl]ethylideneamino]pyridine-4-carboxylate |
| SMILES | COC(=O)c1ccncc1/N=C/CC1CCCc2cc(OCCC(F)(F)F)ccc21 |
| InChI | InChI=1S/C22H23F3N2O3/c1-29-21(28)19-8-10-26-14-20(19)27-11-7-15-3-2-4-16-13-17(5-6-18(15)16)30-12-9-22(23,24)25/h5-6,8,10-11,13-15H,2-4,7,9,12H2,1H3/b27-11+ |
| InChIKey | YYACNYHKTJMOHS-LUOAPIJWSA-N |
| XLogP | 5.41 |
| TPSA | 60.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.43 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|