About [5-(1-methylimidazo[4,5-c]quinolin-8-yl)-1,3-thiazol-2-yl]methanamine
[5-(1-methylimidazo[4,5-c]quinolin-8-yl)-1,3-thiazol-2-yl]methanamine (PubChem CID 123903301) has the molecular formula C15H13N5S
and a molecular weight of 295.37 g/mol. Its IUPAC name is [5-(1-methylimidazo[4,5-c]quinolin-8-yl)-1,3-thiazol-2-yl]methanamine.
Molecular Properties
| Compound Name | [5-(1-methylimidazo[4,5-c]quinolin-8-yl)-1,3-thiazol-2-yl]methanamine |
| PubChem CID | 123903301 |
| Molecular Formula | C15H13N5S |
| Molecular Weight | 295.37 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | [5-(1-methylimidazo[4,5-c]quinolin-8-yl)-1,3-thiazol-2-yl]methanamine |
| SMILES | Cn1cnc2cnc3ccc(-c4cnc(CN)s4)cc3c21 |
| InChI | InChI=1S/C15H13N5S/c1-20-8-19-12-6-17-11-3-2-9(4-10(11)15(12)20)13-7-18-14(5-16)21-13/h2-4,6-8H,5,16H2,1H3 |
| InChIKey | SJXDBJSHUYVDCW-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.37 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [5-(1-methylimidazo[4,5-c]quinolin-8-yl)-1,3-thiazol-2-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(1-methylimidazo[4,5-c]quinolin-8-yl)-1,3-thiazol-2-yl]methanamine?
The IUPAC name of [5-(1-methylimidazo[4,5-c]quinolin-8-yl)-1,3-thiazol-2-yl]methanamine (CID 123903301) is [5-(1-methylimidazo[4,5-c]quinolin-8-yl)-1,3-thiazol-2-yl]methanamine.
What is the SMILES notation for [5-(1-methylimidazo[4,5-c]quinolin-8-yl)-1,3-thiazol-2-yl]methanamine?
The canonical SMILES for [5-(1-methylimidazo[4,5-c]quinolin-8-yl)-1,3-thiazol-2-yl]methanamine is Cn1cnc2cnc3ccc(-c4cnc(CN)s4)cc3c21.
What is the InChIKey of [5-(1-methylimidazo[4,5-c]quinolin-8-yl)-1,3-thiazol-2-yl]methanamine?
The InChIKey is SJXDBJSHUYVDCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13N5S/c1-20-8-19-12-6-17-11-3-2-9(4-10(11)15(12)20)13-7-18-14(5-16)21-13/h2-4,6-8H,5,16H2,1H3.
What are the key properties of [5-(1-methylimidazo[4,5-c]quinolin-8-yl)-1,3-thiazol-2-yl]methanamine?
[5-(1-methylimidazo[4,5-c]quinolin-8-yl)-1,3-thiazol-2-yl]methanamine has a molecular weight of 295.37 g/mol, XLogP of 2.70, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(1-methylimidazo[4,5-c]quinolin-8-yl)-1,3-thiazol-2-yl]methanamine is sourced from PubChem (CID 123903301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).