C22H27B2F2N3O3 — CID 123903340
[(2S)-4,4-difluoro-2-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-benzo[e]benzimidazol-2-yl]pyrrolidin-1-yl]-methylborinic acid (PubChem CID 123903340) has the molecular formula C22H27B2F2N3O3 and a molecular weight of 441.10 g/mol. Its IUPAC name is [(2S)-4,4-difluoro-2-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-benzo[e]benzimidazol-2-yl]pyrrolidin-1-yl]-methylborinic acid.
| Compound Name | [(2S)-4,4-difluoro-2-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-benzo[e]benzimidazol-2-yl]pyrrolidin-1-yl]-methylborinic acid |
|---|---|
| PubChem CID | 123903340 |
| Molecular Formula | C22H27B2F2N3O3 |
| Molecular Weight | 441.10 g/mol |
| Exact Mass | 441.22 |
| IUPAC Name | [(2S)-4,4-difluoro-2-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-benzo[e]benzimidazol-2-yl]pyrrolidin-1-yl]-methylborinic acid |
| SMILES | CB(O)N1CC(F)(F)C[C@H]1c1nc2c(ccc3cc(B4OC(C)(C)C(C)(C)O4)ccc32)[nH]1 |
| InChI | InChI=1S/C22H27B2F2N3O3/c1-20(2)21(3,4)32-24(31-20)14-7-8-15-13(10-14)6-9-16-18(15)28-19(27-16)17-11-22(25,26)12-29(17)23(5)30/h6-10,17,30H,11-12H2,1-5H3,(H,27,28)/t17-/m0/s1 |
| InChIKey | YHRRVNDGSYLAOS-KRWDZBQOSA-N |
| XLogP | 3.51 |
| TPSA | 70.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.10 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|