C25H15N3O10S2 — CID 123903565
4-[3-(furan-2-carbonyl)-1-[5-(4-nitrophenyl)sulfonyl-1,3-thiazol-2-yl]-4,5-dioxopyrrolidin-2-yl]benzoic acid (PubChem CID 123903565) has the molecular formula C25H15N3O10S2 and a molecular weight of 581.54 g/mol. Its IUPAC name is 4-[3-(furan-2-carbonyl)-1-[5-(4-nitrophenyl)sulfonyl-1,3-thiazol-2-yl]-4,5-dioxopyrrolidin-2-yl]benzoic acid.
| Compound Name | 4-[3-(furan-2-carbonyl)-1-[5-(4-nitrophenyl)sulfonyl-1,3-thiazol-2-yl]-4,5-dioxopyrrolidin-2-yl]benzoic acid |
|---|---|
| PubChem CID | 123903565 |
| Molecular Formula | C25H15N3O10S2 |
| Molecular Weight | 581.54 g/mol |
| Exact Mass | 581.02 |
| IUPAC Name | 4-[3-(furan-2-carbonyl)-1-[5-(4-nitrophenyl)sulfonyl-1,3-thiazol-2-yl]-4,5-dioxopyrrolidin-2-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(C2C(C(=O)c3ccco3)C(=O)C(=O)N2c2ncc(S(=O)(=O)c3ccc([N+](=O)[O-])cc3)s2)cc1 |
| InChI | InChI=1S/C25H15N3O10S2/c29-21(17-2-1-11-38-17)19-20(13-3-5-14(6-4-13)24(32)33)27(23(31)22(19)30)25-26-12-18(39-25)40(36,37)16-9-7-15(8-10-16)28(34)35/h1-12,19-20H,(H,32,33) |
| InChIKey | XJEQBSXUZZTSBZ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 195.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.54 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|