C26H34ClN3O3S — CID 123904192
3-(4-chloro-5-hydroxy-14-methoxyimino-11-methyl-12-tricyclo[8.7.0.02,7]heptadeca-2,4,6-trienyl)-N-(5-methyl-1,3-thiazol-2-yl)propanamide (PubChem CID 123904192) has the molecular formula C26H34ClN3O3S and a molecular weight of 504.10 g/mol. Its IUPAC name is 3-(4-chloro-5-hydroxy-14-methoxyimino-11-methyl-12-tricyclo[8.7.0.02,7]heptadeca-2,4,6-trienyl)-N-(5-methyl-1,3-thiazol-2-yl)propanamide.
| Compound Name | 3-(4-chloro-5-hydroxy-14-methoxyimino-11-methyl-12-tricyclo[8.7.0.02,7]heptadeca-2,4,6-trienyl)-N-(5-methyl-1,3-thiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 123904192 |
| Molecular Formula | C26H34ClN3O3S |
| Molecular Weight | 504.10 g/mol |
| Exact Mass | 503.20 |
| IUPAC Name | 3-(4-chloro-5-hydroxy-14-methoxyimino-11-methyl-12-tricyclo[8.7.0.02,7]heptadeca-2,4,6-trienyl)-N-(5-methyl-1,3-thiazol-2-yl)propanamide |
| SMILES | CON=C1CCCC2c3cc(Cl)c(O)cc3CCC2C(C)C(CCC(=O)Nc2ncc(C)s2)C1 |
| InChI | InChI=1S/C26H34ClN3O3S/c1-15-14-28-26(34-15)29-25(32)10-8-17-11-19(30-33-3)5-4-6-21-20(16(17)2)9-7-18-12-24(31)23(27)13-22(18)21/h12-14,16-17,20-21,31H,4-11H2,1-3H3,(H,28,29,32) |
| InChIKey | GPIMQOBFUZCIAY-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.10 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|