C47H36F6N2S2 — CID 123904322
9-ethyl-3-[3-[2-[5-(9-ethylcarbazol-3-yl)-2-methylsulfanylphenyl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-4-methylsulfanylphenyl]carbazole (PubChem CID 123904322) has the molecular formula C47H36F6N2S2 and a molecular weight of 806.94 g/mol. Its IUPAC name is 9-ethyl-3-[3-[2-[5-(9-ethylcarbazol-3-yl)-2-methylsulfanylphenyl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-4-methylsulfanylphenyl]carbazole.
| Compound Name | 9-ethyl-3-[3-[2-[5-(9-ethylcarbazol-3-yl)-2-methylsulfanylphenyl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-4-methylsulfanylphenyl]carbazole |
|---|---|
| PubChem CID | 123904322 |
| Molecular Formula | C47H36F6N2S2 |
| Molecular Weight | 806.94 g/mol |
| Exact Mass | 806.22 |
| IUPAC Name | 9-ethyl-3-[3-[2-[5-(9-ethylcarbazol-3-yl)-2-methylsulfanylphenyl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-4-methylsulfanylphenyl]carbazole |
| SMILES | CCn1c2ccccc2c2cc(-c3ccc(SC)c(C4=C(c5cc(-c6ccc7c(c6)c6ccccc6n7CC)ccc5SC)C(F)(F)C(F)(F)C4(F)F)c3)ccc21 |
| InChI | InChI=1S/C47H36F6N2S2/c1-5-54-37-13-9-7-11-31(37)33-23-27(15-19-39(33)54)29-17-21-41(56-3)35(25-29)43-44(46(50,51)47(52,53)45(43,48)49)36-26-30(18-22-42(36)57-4)28-16-20-40-34(24-28)32-12-8-10-14-38(32)55(40)6-2/h7-26H,5-6H2,1-4H3 |
| InChIKey | DIZXSXZJUFHOPF-UHFFFAOYSA-N |
| XLogP | 14.55 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 806.94 |
| LogP ≤ 5 | 14.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|