C21H32O2 — CID 123904457
[8-ethyl-3-(2-methylcyclobutyl)-8-tricyclo[5.2.1.02,6]decanyl] 2-methylprop-2-enoate (PubChem CID 123904457) has the molecular formula C21H32O2 and a molecular weight of 316.49 g/mol. Its IUPAC name is [8-ethyl-3-(2-methylcyclobutyl)-8-tricyclo[5.2.1.02,6]decanyl] 2-methylprop-2-enoate.
| Compound Name | [8-ethyl-3-(2-methylcyclobutyl)-8-tricyclo[5.2.1.02,6]decanyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 123904457 |
| Molecular Formula | C21H32O2 |
| Molecular Weight | 316.49 g/mol |
| Exact Mass | 316.24 |
| IUPAC Name | [8-ethyl-3-(2-methylcyclobutyl)-8-tricyclo[5.2.1.02,6]decanyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1(CC)CC2CC1C1CCC(C3CCC3C)C21 |
| InChI | InChI=1S/C21H32O2/c1-5-21(23-20(22)12(2)3)11-14-10-18(21)17-9-8-16(19(14)17)15-7-6-13(15)4/h13-19H,2,5-11H2,1,3-4H3 |
| InChIKey | WVFQOEWCRFMNGU-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.49 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|