C31H32N2O4 — CID 123904949
2-[(3R,11S)-5,12-dioxo-3-phenyl-1-oxa-4-azacyclododec-8-en-11-yl]-N-[(4-phenylphenyl)methyl]acetamide (PubChem CID 123904949) has the molecular formula C31H32N2O4 and a molecular weight of 496.61 g/mol. Its IUPAC name is 2-[(3R,11S)-5,12-dioxo-3-phenyl-1-oxa-4-azacyclododec-8-en-11-yl]-N-[(4-phenylphenyl)methyl]acetamide.
| Compound Name | 2-[(3R,11S)-5,12-dioxo-3-phenyl-1-oxa-4-azacyclododec-8-en-11-yl]-N-[(4-phenylphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 123904949 |
| Molecular Formula | C31H32N2O4 |
| Molecular Weight | 496.61 g/mol |
| Exact Mass | 496.24 |
| IUPAC Name | 2-[(3R,11S)-5,12-dioxo-3-phenyl-1-oxa-4-azacyclododec-8-en-11-yl]-N-[(4-phenylphenyl)methyl]acetamide |
| SMILES | O=C(C[C@@H]1CC=CCCC(=O)N[C@H](c2ccccc2)COC1=O)NCc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C31H32N2O4/c34-29-15-9-3-8-14-27(31(36)37-22-28(33-29)26-12-6-2-7-13-26)20-30(35)32-21-23-16-18-25(19-17-23)24-10-4-1-5-11-24/h1-8,10-13,16-19,27-28H,9,14-15,20-22H2,(H,32,35)(H,33,34)/t27-,28-/m0/s1 |
| InChIKey | CHMAVTSDBNJCAG-NSOVKSMOSA-N |
| XLogP | 5.12 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.61 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|