C15H23IO3 — CID 123905119
(3-but-2-enoyl-6-iodo-2,4,4-trimethylcyclohexyl) acetate (PubChem CID 123905119) has the molecular formula C15H23IO3 and a molecular weight of 378.25 g/mol. Its IUPAC name is (3-but-2-enoyl-6-iodo-2,4,4-trimethylcyclohexyl) acetate.
| Compound Name | (3-but-2-enoyl-6-iodo-2,4,4-trimethylcyclohexyl) acetate |
|---|---|
| PubChem CID | 123905119 |
| Molecular Formula | C15H23IO3 |
| Molecular Weight | 378.25 g/mol |
| Exact Mass | 378.07 |
| IUPAC Name | (3-but-2-enoyl-6-iodo-2,4,4-trimethylcyclohexyl) acetate |
| SMILES | CC=CC(=O)C1C(C)C(OC(C)=O)C(I)CC1(C)C |
| InChI | InChI=1S/C15H23IO3/c1-6-7-12(18)13-9(2)14(19-10(3)17)11(16)8-15(13,4)5/h6-7,9,11,13-14H,8H2,1-5H3 |
| InChIKey | NXBCHYGXFSMRSW-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.25 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|