C30H33FN4O — CID 123905470
(E)-1-[4-(3,4-dihydroazocin-2-yl)piperazin-1-yl]-4-[1-(4-fluorophenyl)propylideneamino]-4-phenylbut-3-en-1-one (PubChem CID 123905470) has the molecular formula C30H33FN4O and a molecular weight of 484.62 g/mol. Its IUPAC name is (E)-1-[4-(3,4-dihydroazocin-2-yl)piperazin-1-yl]-4-[1-(4-fluorophenyl)propylideneamino]-4-phenylbut-3-en-1-one.
| Compound Name | (E)-1-[4-(3,4-dihydroazocin-2-yl)piperazin-1-yl]-4-[1-(4-fluorophenyl)propylideneamino]-4-phenylbut-3-en-1-one |
|---|---|
| PubChem CID | 123905470 |
| Molecular Formula | C30H33FN4O |
| Molecular Weight | 484.62 g/mol |
| Exact Mass | 484.26 |
| IUPAC Name | (E)-1-[4-(3,4-dihydroazocin-2-yl)piperazin-1-yl]-4-[1-(4-fluorophenyl)propylideneamino]-4-phenylbut-3-en-1-one |
| SMILES | CC/C(=N\C(=C\CC(=O)N1CCN(/C2=N/C=CC=CCC2)CC1)c1ccccc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C30H33FN4O/c1-2-27(25-13-15-26(31)16-14-25)33-28(24-10-6-5-7-11-24)17-18-30(36)35-22-20-34(21-23-35)29-12-8-3-4-9-19-32-29/h3-7,9-11,13-17,19H,2,8,12,18,20-23H2,1H3/b4-3?,19-9?,28-17+,32-29+,33-27+ |
| InChIKey | ASAUFCZVBRHPSV-CAAHOGBCSA-N |
| XLogP | 5.86 |
| TPSA | 48.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.62 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|