C21H13F5 — CID 123905561
5-[4-[4-(1,2-difluoroprop-1-enyl)phenyl]phenyl]-1,2,3-trifluorobenzene (PubChem CID 123905561) has the molecular formula C21H13F5 and a molecular weight of 360.33 g/mol. Its IUPAC name is 5-[4-[4-(1,2-difluoroprop-1-enyl)phenyl]phenyl]-1,2,3-trifluorobenzene.
| Compound Name | 5-[4-[4-(1,2-difluoroprop-1-enyl)phenyl]phenyl]-1,2,3-trifluorobenzene |
|---|---|
| PubChem CID | 123905561 |
| Molecular Formula | C21H13F5 |
| Molecular Weight | 360.33 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | 5-[4-[4-(1,2-difluoroprop-1-enyl)phenyl]phenyl]-1,2,3-trifluorobenzene |
| SMILES | CC(F)=C(F)c1ccc(-c2ccc(-c3cc(F)c(F)c(F)c3)cc2)cc1 |
| InChI | InChI=1S/C21H13F5/c1-12(22)20(25)16-8-6-14(7-9-16)13-2-4-15(5-3-13)17-10-18(23)21(26)19(24)11-17/h2-11H,1H3 |
| InChIKey | MYYRBQCMHNQGJT-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.33 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|