C18H33N7O3S — CID 123905792
3-[1-(3-amino-2-methylpropyl)-5-[2-[(2,4-dioxo-1H-pyrimidin-5-yl)methylamino]ethyl]pyrrolidin-3-yl]-1-methyl-1-methylsulfanylurea (PubChem CID 123905792) has the molecular formula C18H33N7O3S and a molecular weight of 427.58 g/mol. Its IUPAC name is 3-[1-(3-amino-2-methylpropyl)-5-[2-[(2,4-dioxo-1H-pyrimidin-5-yl)methylamino]ethyl]pyrrolidin-3-yl]-1-methyl-1-methylsulfanylurea.
| Compound Name | 3-[1-(3-amino-2-methylpropyl)-5-[2-[(2,4-dioxo-1H-pyrimidin-5-yl)methylamino]ethyl]pyrrolidin-3-yl]-1-methyl-1-methylsulfanylurea |
|---|---|
| PubChem CID | 123905792 |
| Molecular Formula | C18H33N7O3S |
| Molecular Weight | 427.58 g/mol |
| Exact Mass | 427.24 |
| IUPAC Name | 3-[1-(3-amino-2-methylpropyl)-5-[2-[(2,4-dioxo-1H-pyrimidin-5-yl)methylamino]ethyl]pyrrolidin-3-yl]-1-methyl-1-methylsulfanylurea |
| SMILES | CSN(C)C(=O)NC1CC(CCNCc2c[nH]c(=O)[nH]c2=O)N(CC(C)CN)C1 |
| InChI | InChI=1S/C18H33N7O3S/c1-12(7-19)10-25-11-14(22-18(28)24(2)29-3)6-15(25)4-5-20-8-13-9-21-17(27)23-16(13)26/h9,12,14-15,20H,4-8,10-11,19H2,1-3H3,(H,22,28)(H2,21,23,26,27) |
| InChIKey | HNTQKJLVYHBCTD-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 139.35 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.58 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|