C21H19FN2O4 — CID 123906956
ethyl 6-[2-fluoro-5-[2-(3-hydroxy-1-methyl-2-oxopyrrolidin-3-yl)ethynyl]phenyl]pyridine-2-carboxylate (PubChem CID 123906956) has the molecular formula C21H19FN2O4 and a molecular weight of 382.39 g/mol. Its IUPAC name is ethyl 6-[2-fluoro-5-[2-(3-hydroxy-1-methyl-2-oxopyrrolidin-3-yl)ethynyl]phenyl]pyridine-2-carboxylate.
| Compound Name | ethyl 6-[2-fluoro-5-[2-(3-hydroxy-1-methyl-2-oxopyrrolidin-3-yl)ethynyl]phenyl]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 123906956 |
| Molecular Formula | C21H19FN2O4 |
| Molecular Weight | 382.39 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | ethyl 6-[2-fluoro-5-[2-(3-hydroxy-1-methyl-2-oxopyrrolidin-3-yl)ethynyl]phenyl]pyridine-2-carboxylate |
| SMILES | CCOC(=O)c1cccc(-c2cc(C#CC3(O)CCN(C)C3=O)ccc2F)n1 |
| InChI | InChI=1S/C21H19FN2O4/c1-3-28-19(25)18-6-4-5-17(23-18)15-13-14(7-8-16(15)22)9-10-21(27)11-12-24(2)20(21)26/h4-8,13,27H,3,11-12H2,1-2H3 |
| InChIKey | KYXMBOXJANGTQA-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.39 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|