About 6-(hydroxymethylimino)-2,2-dimethyl-3,4-dihydrobenzo[h]chromen-5-one
6-(hydroxymethylimino)-2,2-dimethyl-3,4-dihydrobenzo[h]chromen-5-one (PubChem CID 123907391) has the molecular formula C16H17NO3
and a molecular weight of 271.32 g/mol. Its IUPAC name is 6-(hydroxymethylimino)-2,2-dimethyl-3,4-dihydrobenzo[h]chromen-5-one.
Molecular Properties
| Compound Name | 6-(hydroxymethylimino)-2,2-dimethyl-3,4-dihydrobenzo[h]chromen-5-one |
| PubChem CID | 123907391 |
| Molecular Formula | C16H17NO3 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 6-(hydroxymethylimino)-2,2-dimethyl-3,4-dihydrobenzo[h]chromen-5-one |
| SMILES | CC1(C)CCC2=C(O1)c1ccccc1C(=NCO)C2=O |
| InChI | InChI=1S/C16H17NO3/c1-16(2)8-7-12-14(19)13(17-9-18)10-5-3-4-6-11(10)15(12)20-16/h3-6,18H,7-9H2,1-2H3 |
| InChIKey | NQNXKBDEHAOZSS-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 6-(hydroxymethylimino)-2,2-dimethyl-3,4-dihydrobenzo[h]chromen-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(hydroxymethylimino)-2,2-dimethyl-3,4-dihydrobenzo[h]chromen-5-one?
The IUPAC name of 6-(hydroxymethylimino)-2,2-dimethyl-3,4-dihydrobenzo[h]chromen-5-one (CID 123907391) is 6-(hydroxymethylimino)-2,2-dimethyl-3,4-dihydrobenzo[h]chromen-5-one.
What is the SMILES notation for 6-(hydroxymethylimino)-2,2-dimethyl-3,4-dihydrobenzo[h]chromen-5-one?
The canonical SMILES for 6-(hydroxymethylimino)-2,2-dimethyl-3,4-dihydrobenzo[h]chromen-5-one is CC1(C)CCC2=C(O1)c1ccccc1C(=NCO)C2=O.
What is the InChIKey of 6-(hydroxymethylimino)-2,2-dimethyl-3,4-dihydrobenzo[h]chromen-5-one?
The InChIKey is NQNXKBDEHAOZSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17NO3/c1-16(2)8-7-12-14(19)13(17-9-18)10-5-3-4-6-11(10)15(12)20-16/h3-6,18H,7-9H2,1-2H3.
What are the key properties of 6-(hydroxymethylimino)-2,2-dimethyl-3,4-dihydrobenzo[h]chromen-5-one?
6-(hydroxymethylimino)-2,2-dimethyl-3,4-dihydrobenzo[h]chromen-5-one has a molecular weight of 271.32 g/mol, XLogP of 2.31, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(hydroxymethylimino)-2,2-dimethyl-3,4-dihydrobenzo[h]chromen-5-one is sourced from PubChem (CID 123907391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).