C12H18O2 — CID 123907638
3a,4,5,8,9,10,11,11a-octahydro-3H-cyclodeca[b]furan-2-one (PubChem CID 123907638) has the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. Its IUPAC name is 3a,4,5,8,9,10,11,11a-octahydro-3H-cyclodeca[b]furan-2-one.
| Compound Name | 3a,4,5,8,9,10,11,11a-octahydro-3H-cyclodeca[b]furan-2-one |
|---|---|
| PubChem CID | 123907638 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | 3a,4,5,8,9,10,11,11a-octahydro-3H-cyclodeca[b]furan-2-one |
| SMILES | O=C1CC2CCC=CCCCCC2O1 |
| InChI | InChI=1S/C12H18O2/c13-12-9-10-7-5-3-1-2-4-6-8-11(10)14-12/h1,3,10-11H,2,4-9H2 |
| InChIKey | DKEIYVLEEJZSHO-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|