C22H33N3O5 — CID 123907745
1-formyl-N-[1-[(1-hydroxy-1-methoxy-3-phenylpropan-2-yl)amino]-4-methyl-1-oxopentan-2-yl]pyrrolidine-2-carboxamide (PubChem CID 123907745) has the molecular formula C22H33N3O5 and a molecular weight of 419.52 g/mol. Its IUPAC name is 1-formyl-N-[1-[(1-hydroxy-1-methoxy-3-phenylpropan-2-yl)amino]-4-methyl-1-oxopentan-2-yl]pyrrolidine-2-carboxamide.
| Compound Name | 1-formyl-N-[1-[(1-hydroxy-1-methoxy-3-phenylpropan-2-yl)amino]-4-methyl-1-oxopentan-2-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 123907745 |
| Molecular Formula | C22H33N3O5 |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.24 |
| IUPAC Name | 1-formyl-N-[1-[(1-hydroxy-1-methoxy-3-phenylpropan-2-yl)amino]-4-methyl-1-oxopentan-2-yl]pyrrolidine-2-carboxamide |
| SMILES | COC(O)C(Cc1ccccc1)NC(=O)C(CC(C)C)NC(=O)C1CCCN1C=O |
| InChI | InChI=1S/C22H33N3O5/c1-15(2)12-17(23-21(28)19-10-7-11-25(19)14-26)20(27)24-18(22(29)30-3)13-16-8-5-4-6-9-16/h4-6,8-9,14-15,17-19,22,29H,7,10-13H2,1-3H3,(H,23,28)(H,24,27) |
| InChIKey | CHIHQRQCYFACAM-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|