C30H30O9 — CID 123907746
7-methyl-2,4-bis[(2,3,4-trimethoxyphenyl)methylidene]-1,5-benzodioxepin-3-one (PubChem CID 123907746) has the molecular formula C30H30O9 and a molecular weight of 534.56 g/mol. Its IUPAC name is 7-methyl-2,4-bis[(2,3,4-trimethoxyphenyl)methylidene]-1,5-benzodioxepin-3-one.
| Compound Name | 7-methyl-2,4-bis[(2,3,4-trimethoxyphenyl)methylidene]-1,5-benzodioxepin-3-one |
|---|---|
| PubChem CID | 123907746 |
| Molecular Formula | C30H30O9 |
| Molecular Weight | 534.56 g/mol |
| Exact Mass | 534.19 |
| IUPAC Name | 7-methyl-2,4-bis[(2,3,4-trimethoxyphenyl)methylidene]-1,5-benzodioxepin-3-one |
| SMILES | COc1ccc(C=C2Oc3ccc(C)cc3OC(=Cc3ccc(OC)c(OC)c3OC)C2=O)c(OC)c1OC |
| InChI | InChI=1S/C30H30O9/c1-17-8-11-20-23(14-17)39-25(16-19-10-13-22(33-3)30(37-7)28(19)35-5)26(31)24(38-20)15-18-9-12-21(32-2)29(36-6)27(18)34-4/h8-16H,1-7H3 |
| InChIKey | ADGQHFXPZZGITG-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 90.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.56 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|