C30H46O3S — CID 123908524
(3R,6aR,6bS,8aR,11R,12S,12aR,14aR,14bS)-4,6a,6b,8a,11,12,14b-heptamethyl-14-oxo-3-sulfanyl-1,2,3,4a,5,6,7,8,9,10,11,12,12a,14a-tetradecahydropicene-4-carboxylic acid (PubChem CID 123908524) has the molecular formula C30H46O3S and a molecular weight of 486.76 g/mol. Its IUPAC name is (3R,6aR,6bS,8aR,11R,12S,12aR,14aR,14bS)-4,6a,6b,8a,11,12,14b-heptamethyl-14-oxo-3-sulfanyl-1,2,3,4a,5,6,7,8,9,10,11,12,12a,14a-tetradecahydropicene-4-carboxylic acid.
| Compound Name | (3R,6aR,6bS,8aR,11R,12S,12aR,14aR,14bS)-4,6a,6b,8a,11,12,14b-heptamethyl-14-oxo-3-sulfanyl-1,2,3,4a,5,6,7,8,9,10,11,12,12a,14a-tetradecahydropicene-4-carboxylic acid |
|---|---|
| PubChem CID | 123908524 |
| Molecular Formula | C30H46O3S |
| Molecular Weight | 486.76 g/mol |
| Exact Mass | 486.32 |
| IUPAC Name | (3R,6aR,6bS,8aR,11R,12S,12aR,14aR,14bS)-4,6a,6b,8a,11,12,14b-heptamethyl-14-oxo-3-sulfanyl-1,2,3,4a,5,6,7,8,9,10,11,12,12a,14a-tetradecahydropicene-4-carboxylic acid |
| SMILES | C[C@H]1[C@H](C)CC[C@]2(C)CC[C@]3(C)C(=CC(=O)[C@@H]4[C@@]5(C)CC[C@@H](S)C(C)(C(=O)O)C5CC[C@]43C)[C@H]12 |
| InChI | InChI=1S/C30H46O3S/c1-17-8-11-26(3)14-15-28(5)19(23(26)18(17)2)16-20(31)24-27(4)12-10-22(34)30(7,25(32)33)21(27)9-13-29(24,28)6/h16-18,21-24,34H,8-15H2,1-7H3,(H,32,33)/t17-,18+,21?,22-,23+,24-,26-,27+,28-,29-,30?/m1/s1 |
| InChIKey | AGVNNFNLQJUOSC-NUXQKBMCSA-N |
| XLogP | 7.21 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.76 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|