C30H36N3O4S+ — CID 123910034
methyl-methylidene-[6-[2-[5-(morpholin-4-ylmethyl)thiophen-2-yl]furo[3,2-b]pyridin-7-yl]-3-(oxan-4-yloxy)hepta-2,4,6-trien-2-yl]azanium (PubChem CID 123910034) has the molecular formula C30H36N3O4S+ and a molecular weight of 534.70 g/mol. Its IUPAC name is methyl-methylidene-[6-[2-[5-(morpholin-4-ylmethyl)thiophen-2-yl]furo[3,2-b]pyridin-7-yl]-3-(oxan-4-yloxy)hepta-2,4,6-trien-2-yl]azanium.
| Compound Name | methyl-methylidene-[6-[2-[5-(morpholin-4-ylmethyl)thiophen-2-yl]furo[3,2-b]pyridin-7-yl]-3-(oxan-4-yloxy)hepta-2,4,6-trien-2-yl]azanium |
|---|---|
| PubChem CID | 123910034 |
| Molecular Formula | C30H36N3O4S+ |
| Molecular Weight | 534.70 g/mol |
| Exact Mass | 534.24 |
| IUPAC Name | methyl-methylidene-[6-[2-[5-(morpholin-4-ylmethyl)thiophen-2-yl]furo[3,2-b]pyridin-7-yl]-3-(oxan-4-yloxy)hepta-2,4,6-trien-2-yl]azanium |
| SMILES | C=C(C=CC(OC1CCOCC1)=C(C)[N+](=C)C)c1ccnc2cc(-c3ccc(CN4CCOCC4)s3)oc12 |
| InChI | InChI=1S/C30H36N3O4S/c1-21(5-7-27(22(2)32(3)4)36-23-10-15-34-16-11-23)25-9-12-31-26-19-28(37-30(25)26)29-8-6-24(38-29)20-33-13-17-35-18-14-33/h5-9,12,19,23H,1,3,10-11,13-18,20H2,2,4H3/q+1 |
| InChIKey | JPERESHMHKWPBM-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 59.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.70 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|