About 1-[1-(4,6-dihydropyren-1-yl)ethyl]-4-propan-2-yltriazole
1-[1-(4,6-dihydropyren-1-yl)ethyl]-4-propan-2-yltriazole (PubChem CID 123910182) has the molecular formula C23H23N3
and a molecular weight of 341.46 g/mol. Its IUPAC name is 1-[1-(4,6-dihydropyren-1-yl)ethyl]-4-propan-2-yltriazole.
Molecular Properties
| Compound Name | 1-[1-(4,6-dihydropyren-1-yl)ethyl]-4-propan-2-yltriazole |
| PubChem CID | 123910182 |
| Molecular Formula | C23H23N3 |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | 1-[1-(4,6-dihydropyren-1-yl)ethyl]-4-propan-2-yltriazole |
| SMILES | CC(C)c1cn(C(C)c2ccc3c4c5c(ccc24)C=CCC5=CC3)nn1 |
| InChI | InChI=1S/C23H23N3/c1-14(2)21-13-26(25-24-21)15(3)19-11-9-18-8-7-16-5-4-6-17-10-12-20(19)23(18)22(16)17/h4,6-7,9-15H,5,8H2,1-3H3 |
| InChIKey | AEHJXWRQYWDOIO-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[1-(4,6-dihydropyren-1-yl)ethyl]-4-propan-2-yltriazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-(4,6-dihydropyren-1-yl)ethyl]-4-propan-2-yltriazole?
The IUPAC name of 1-[1-(4,6-dihydropyren-1-yl)ethyl]-4-propan-2-yltriazole (CID 123910182) is 1-[1-(4,6-dihydropyren-1-yl)ethyl]-4-propan-2-yltriazole.
What is the SMILES notation for 1-[1-(4,6-dihydropyren-1-yl)ethyl]-4-propan-2-yltriazole?
The canonical SMILES for 1-[1-(4,6-dihydropyren-1-yl)ethyl]-4-propan-2-yltriazole is CC(C)c1cn(C(C)c2ccc3c4c5c(ccc24)C=CCC5=CC3)nn1.
What is the InChIKey of 1-[1-(4,6-dihydropyren-1-yl)ethyl]-4-propan-2-yltriazole?
The InChIKey is AEHJXWRQYWDOIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H23N3/c1-14(2)21-13-26(25-24-21)15(3)19-11-9-18-8-7-16-5-4-6-17-10-12-20(19)23(18)22(16)17/h4,6-7,9-15H,5,8H2,1-3H3.
What are the key properties of 1-[1-(4,6-dihydropyren-1-yl)ethyl]-4-propan-2-yltriazole?
1-[1-(4,6-dihydropyren-1-yl)ethyl]-4-propan-2-yltriazole has a molecular weight of 341.46 g/mol, XLogP of 5.52, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-(4,6-dihydropyren-1-yl)ethyl]-4-propan-2-yltriazole is sourced from PubChem (CID 123910182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).