C21H20ClFN4O4S2 — CID 123910227
N-[1-[3-(4-chlorophenyl)-1-cyanopent-1-en-3-yl]-6-fluoroindazol-4-yl]-N-methylsulfonylmethanesulfonamide (PubChem CID 123910227) has the molecular formula C21H20ClFN4O4S2 and a molecular weight of 511.00 g/mol. Its IUPAC name is N-[1-[3-(4-chlorophenyl)-1-cyanopent-1-en-3-yl]-6-fluoroindazol-4-yl]-N-methylsulfonylmethanesulfonamide.
| Compound Name | N-[1-[3-(4-chlorophenyl)-1-cyanopent-1-en-3-yl]-6-fluoroindazol-4-yl]-N-methylsulfonylmethanesulfonamide |
|---|---|
| PubChem CID | 123910227 |
| Molecular Formula | C21H20ClFN4O4S2 |
| Molecular Weight | 511.00 g/mol |
| Exact Mass | 510.06 |
| IUPAC Name | N-[1-[3-(4-chlorophenyl)-1-cyanopent-1-en-3-yl]-6-fluoroindazol-4-yl]-N-methylsulfonylmethanesulfonamide |
| SMILES | CCC(C=CC#N)(c1ccc(Cl)cc1)n1ncc2c(N(S(C)(=O)=O)S(C)(=O)=O)cc(F)cc21 |
| InChI | InChI=1S/C21H20ClFN4O4S2/c1-4-21(10-5-11-24,15-6-8-16(22)9-7-15)26-19-12-17(23)13-20(18(19)14-25-26)27(32(2,28)29)33(3,30)31/h5-10,12-14H,4H2,1-3H3 |
| InChIKey | CTODNKMGTODVHW-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 113.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.00 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|