C54H41N7O4 — CID 123910317
2-[3-[4-[15-(4-methoxyphenyl)-10,20-dipyridin-4-yl-21,22,23,24-tetrahydroporphyrin-5-yl]phenoxy]propyl]isoindole-1,3-dione (PubChem CID 123910317) has the molecular formula C54H41N7O4 and a molecular weight of 851.97 g/mol. Its IUPAC name is 2-[3-[4-[15-(4-methoxyphenyl)-10,20-dipyridin-4-yl-21,22,23,24-tetrahydroporphyrin-5-yl]phenoxy]propyl]isoindole-1,3-dione.
| Compound Name | 2-[3-[4-[15-(4-methoxyphenyl)-10,20-dipyridin-4-yl-21,22,23,24-tetrahydroporphyrin-5-yl]phenoxy]propyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 123910317 |
| Molecular Formula | C54H41N7O4 |
| Molecular Weight | 851.97 g/mol |
| Exact Mass | 851.32 |
| IUPAC Name | 2-[3-[4-[15-(4-methoxyphenyl)-10,20-dipyridin-4-yl-21,22,23,24-tetrahydroporphyrin-5-yl]phenoxy]propyl]isoindole-1,3-dione |
| SMILES | COc1ccc(C2=c3ccc([nH]3)=C(c3ccncc3)c3ccc([nH]3)C(c3ccc(OCCCN4C(=O)c5ccccc5C4=O)cc3)=c3ccc([nH]3)=C(c3ccncc3)c3ccc2[nH]3)cc1 |
| InChI | InChI=1S/C54H41N7O4/c1-64-37-11-7-33(8-12-37)49-41-15-19-45(57-41)51(35-23-27-55-28-24-35)47-21-17-43(59-47)50(44-18-22-48(60-44)52(36-25-29-56-30-26-36)46-20-16-42(49)58-46)34-9-13-38(14-10-34)65-32-4-31-61-53(62)39-5-2-3-6-40(39)54(61)63/h2-3,5-30,57-60H,4,31-32H2,1H3 |
| InChIKey | FINDMCVEELGDTC-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 144.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 851.97 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|