C25H30FN7 — CID 123910325
1-[4-(4-amino-3-fluorophenyl)-5-(2,3,7-trimethyl-6,7-dihydroindazol-5-yl)pyrimidin-2-yl]piperidin-4-amine (PubChem CID 123910325) has the molecular formula C25H30FN7 and a molecular weight of 447.56 g/mol. Its IUPAC name is 1-[4-(4-amino-3-fluorophenyl)-5-(2,3,7-trimethyl-6,7-dihydroindazol-5-yl)pyrimidin-2-yl]piperidin-4-amine.
| Compound Name | 1-[4-(4-amino-3-fluorophenyl)-5-(2,3,7-trimethyl-6,7-dihydroindazol-5-yl)pyrimidin-2-yl]piperidin-4-amine |
|---|---|
| PubChem CID | 123910325 |
| Molecular Formula | C25H30FN7 |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 447.25 |
| IUPAC Name | 1-[4-(4-amino-3-fluorophenyl)-5-(2,3,7-trimethyl-6,7-dihydroindazol-5-yl)pyrimidin-2-yl]piperidin-4-amine |
| SMILES | Cc1c2c(nn1C)C(C)CC(c1cnc(N3CCC(N)CC3)nc1-c1ccc(N)c(F)c1)=C2 |
| InChI | InChI=1S/C25H30FN7/c1-14-10-17(11-19-15(2)32(3)31-23(14)19)20-13-29-25(33-8-6-18(27)7-9-33)30-24(20)16-4-5-22(28)21(26)12-16/h4-5,11-14,18H,6-10,27-28H2,1-3H3 |
| InChIKey | WONSJEYKEBSRBN-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 98.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|