About 2,5-dimethylhex-3-enyl sulfamate
2,5-dimethylhex-3-enyl sulfamate (PubChem CID 123910726) has the molecular formula C8H17NO3S
and a molecular weight of 207.29 g/mol. Its IUPAC name is 2,5-dimethylhex-3-enyl sulfamate.
Molecular Properties
| Compound Name | 2,5-dimethylhex-3-enyl sulfamate |
| PubChem CID | 123910726 |
| Molecular Formula | C8H17NO3S |
| Molecular Weight | 207.29 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | 2,5-dimethylhex-3-enyl sulfamate |
| SMILES | CC(C)C=CC(C)COS(N)(=O)=O |
| InChI | InChI=1S/C8H17NO3S/c1-7(2)4-5-8(3)6-12-13(9,10)11/h4-5,7-8H,6H2,1-3H3,(H2,9,10,11) |
| InChIKey | YXCIMUYUNKGZMK-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.29 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2,5-dimethylhex-3-enyl sulfamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dimethylhex-3-enyl sulfamate?
The IUPAC name of 2,5-dimethylhex-3-enyl sulfamate (CID 123910726) is 2,5-dimethylhex-3-enyl sulfamate.
What is the SMILES notation for 2,5-dimethylhex-3-enyl sulfamate?
The canonical SMILES for 2,5-dimethylhex-3-enyl sulfamate is CC(C)C=CC(C)COS(N)(=O)=O.
What is the InChIKey of 2,5-dimethylhex-3-enyl sulfamate?
The InChIKey is YXCIMUYUNKGZMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO3S/c1-7(2)4-5-8(3)6-12-13(9,10)11/h4-5,7-8H,6H2,1-3H3,(H2,9,10,11).
What are the key properties of 2,5-dimethylhex-3-enyl sulfamate?
2,5-dimethylhex-3-enyl sulfamate has a molecular weight of 207.29 g/mol, XLogP of 1.05, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dimethylhex-3-enyl sulfamate is sourced from PubChem (CID 123910726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).