About dimethyl 2-[C-methyl-N-(1,3-thiazol-2-ylmethyl)carbonimidoyl]pent-2-enedioate
dimethyl 2-[C-methyl-N-(1,3-thiazol-2-ylmethyl)carbonimidoyl]pent-2-enedioate (PubChem CID 123911031) has the molecular formula C13H16N2O4S
and a molecular weight of 296.35 g/mol. Its IUPAC name is dimethyl 2-[C-methyl-N-(1,3-thiazol-2-ylmethyl)carbonimidoyl]pent-2-enedioate.
Molecular Properties
| Compound Name | dimethyl 2-[C-methyl-N-(1,3-thiazol-2-ylmethyl)carbonimidoyl]pent-2-enedioate |
| PubChem CID | 123911031 |
| Molecular Formula | C13H16N2O4S |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | dimethyl 2-[C-methyl-N-(1,3-thiazol-2-ylmethyl)carbonimidoyl]pent-2-enedioate |
| SMILES | COC(=O)CC=C(C(=O)OC)/C(C)=N/Cc1nccs1 |
| InChI | InChI=1S/C13H16N2O4S/c1-9(15-8-11-14-6-7-20-11)10(13(17)19-3)4-5-12(16)18-2/h4,6-7H,5,8H2,1-3H3/b10-4?,15-9+ |
| InChIKey | DMTDDZOFZJIHGC-LMLGRSNESA-N |
| XLogP | 1.77 |
| TPSA | 77.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze dimethyl 2-[C-methyl-N-(1,3-thiazol-2-ylmethyl)carbonimidoyl]pent-2-enedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 2-[C-methyl-N-(1,3-thiazol-2-ylmethyl)carbonimidoyl]pent-2-enedioate?
The IUPAC name of dimethyl 2-[C-methyl-N-(1,3-thiazol-2-ylmethyl)carbonimidoyl]pent-2-enedioate (CID 123911031) is dimethyl 2-[C-methyl-N-(1,3-thiazol-2-ylmethyl)carbonimidoyl]pent-2-enedioate.
What is the SMILES notation for dimethyl 2-[C-methyl-N-(1,3-thiazol-2-ylmethyl)carbonimidoyl]pent-2-enedioate?
The canonical SMILES for dimethyl 2-[C-methyl-N-(1,3-thiazol-2-ylmethyl)carbonimidoyl]pent-2-enedioate is COC(=O)CC=C(C(=O)OC)/C(C)=N/Cc1nccs1.
What is the InChIKey of dimethyl 2-[C-methyl-N-(1,3-thiazol-2-ylmethyl)carbonimidoyl]pent-2-enedioate?
The InChIKey is DMTDDZOFZJIHGC-LMLGRSNESA-N. The full InChI is InChI=1S/C13H16N2O4S/c1-9(15-8-11-14-6-7-20-11)10(13(17)19-3)4-5-12(16)18-2/h4,6-7H,5,8H2,1-3H3/b10-4?,15-9+.
What are the key properties of dimethyl 2-[C-methyl-N-(1,3-thiazol-2-ylmethyl)carbonimidoyl]pent-2-enedioate?
dimethyl 2-[C-methyl-N-(1,3-thiazol-2-ylmethyl)carbonimidoyl]pent-2-enedioate has a molecular weight of 296.35 g/mol, XLogP of 1.77, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 2-[C-methyl-N-(1,3-thiazol-2-ylmethyl)carbonimidoyl]pent-2-enedioate is sourced from PubChem (CID 123911031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).