C8H9F10O5S- — CID 123911042
1,1,1,3,3-pentafluoro-3-propan-2-yloxypropane;1,1,2,2-tetrafluoro-2-fluorooxyethanesulfonate (PubChem CID 123911042) has the molecular formula C8H9F10O5S- and a molecular weight of 407.20 g/mol. Its IUPAC name is 1,1,1,3,3-pentafluoro-3-propan-2-yloxypropane;1,1,2,2-tetrafluoro-2-fluorooxyethanesulfonate.
| Compound Name | 1,1,1,3,3-pentafluoro-3-propan-2-yloxypropane;1,1,2,2-tetrafluoro-2-fluorooxyethanesulfonate |
|---|---|
| PubChem CID | 123911042 |
| Molecular Formula | C8H9F10O5S- |
| Molecular Weight | 407.20 g/mol |
| Exact Mass | 407.00 |
| IUPAC Name | 1,1,1,3,3-pentafluoro-3-propan-2-yloxypropane;1,1,2,2-tetrafluoro-2-fluorooxyethanesulfonate |
| SMILES | CC(C)OC(F)(F)CC(F)(F)F.O=S(=O)([O-])C(F)(F)C(F)(F)OF |
| InChI | InChI=1S/C6H9F5O.C2HF5O4S/c1-4(2)12-6(10,11)3-5(7,8)9;3-1(4,11-7)2(5,6)12(8,9)10/h4H,3H2,1-2H3;(H,8,9,10)/p-1 |
| InChIKey | PPHJPIZBUZJCQQ-UHFFFAOYSA-M |
| XLogP | 3.57 |
| TPSA | 75.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.20 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|