C18H16FNOS — CID 123911351
(5-amino-2-methylphenyl)-[5-(4-fluorocyclohexa-1,3-dien-1-yl)thiophen-2-yl]methanone (PubChem CID 123911351) has the molecular formula C18H16FNOS and a molecular weight of 313.40 g/mol. Its IUPAC name is (5-amino-2-methylphenyl)-[5-(4-fluorocyclohexa-1,3-dien-1-yl)thiophen-2-yl]methanone.
| Compound Name | (5-amino-2-methylphenyl)-[5-(4-fluorocyclohexa-1,3-dien-1-yl)thiophen-2-yl]methanone |
|---|---|
| PubChem CID | 123911351 |
| Molecular Formula | C18H16FNOS |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | (5-amino-2-methylphenyl)-[5-(4-fluorocyclohexa-1,3-dien-1-yl)thiophen-2-yl]methanone |
| SMILES | Cc1ccc(N)cc1C(=O)c1ccc(C2=CC=C(F)CC2)s1 |
| InChI | InChI=1S/C18H16FNOS/c1-11-2-7-14(20)10-15(11)18(21)17-9-8-16(22-17)12-3-5-13(19)6-4-12/h2-3,5,7-10H,4,6,20H2,1H3 |
| InChIKey | IJTFFVGVVFIRMZ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|