C22H28O4 — CID 123911474
9-(hydroxymethyl)-11-methyl-5-methylidene-14-oxapentacyclo[9.4.3.24,7.01,10.02,7]icos-12-ene-6,8-dione (PubChem CID 123911474) has the molecular formula C22H28O4 and a molecular weight of 356.46 g/mol. Its IUPAC name is 9-(hydroxymethyl)-11-methyl-5-methylidene-14-oxapentacyclo[9.4.3.24,7.01,10.02,7]icos-12-ene-6,8-dione.
| Compound Name | 9-(hydroxymethyl)-11-methyl-5-methylidene-14-oxapentacyclo[9.4.3.24,7.01,10.02,7]icos-12-ene-6,8-dione |
|---|---|
| PubChem CID | 123911474 |
| Molecular Formula | C22H28O4 |
| Molecular Weight | 356.46 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | 9-(hydroxymethyl)-11-methyl-5-methylidene-14-oxapentacyclo[9.4.3.24,7.01,10.02,7]icos-12-ene-6,8-dione |
| SMILES | C=C1C(=O)C23CCC1CC2C12CCCC(C)(C=COC1)C2C(CO)C3=O |
| InChI | InChI=1S/C22H28O4/c1-13-14-4-7-22(18(13)24)16(10-14)21-6-3-5-20(2,8-9-26-12-21)17(21)15(11-23)19(22)25/h8-9,14-17,23H,1,3-7,10-12H2,2H3 |
| InChIKey | FLBDLAFRRFWXHO-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.46 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|