About 5-isocyano-4-N,6-N-dimethylpyrimidine-4,6-diamine
5-isocyano-4-N,6-N-dimethylpyrimidine-4,6-diamine (PubChem CID 123911501) has the molecular formula C7H9N5
and a molecular weight of 163.18 g/mol. Its IUPAC name is 5-isocyano-4-N,6-N-dimethylpyrimidine-4,6-diamine.
Molecular Properties
| Compound Name | 5-isocyano-4-N,6-N-dimethylpyrimidine-4,6-diamine |
| PubChem CID | 123911501 |
| Molecular Formula | C7H9N5 |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.09 |
| IUPAC Name | 5-isocyano-4-N,6-N-dimethylpyrimidine-4,6-diamine |
| SMILES | [C-]#[N+]c1c(NC)ncnc1NC |
| InChI | InChI=1S/C7H9N5/c1-8-5-6(9-2)11-4-12-7(5)10-3/h4H,2-3H3,(H2,9,10,11,12) |
| InChIKey | BUNCJUMYELTENX-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 54.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 5-isocyano-4-N,6-N-dimethylpyrimidine-4,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-isocyano-4-N,6-N-dimethylpyrimidine-4,6-diamine?
The IUPAC name of 5-isocyano-4-N,6-N-dimethylpyrimidine-4,6-diamine (CID 123911501) is 5-isocyano-4-N,6-N-dimethylpyrimidine-4,6-diamine.
What is the SMILES notation for 5-isocyano-4-N,6-N-dimethylpyrimidine-4,6-diamine?
The canonical SMILES for 5-isocyano-4-N,6-N-dimethylpyrimidine-4,6-diamine is [C-]#[N+]c1c(NC)ncnc1NC.
What is the InChIKey of 5-isocyano-4-N,6-N-dimethylpyrimidine-4,6-diamine?
The InChIKey is BUNCJUMYELTENX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N5/c1-8-5-6(9-2)11-4-12-7(5)10-3/h4H,2-3H3,(H2,9,10,11,12).
What are the key properties of 5-isocyano-4-N,6-N-dimethylpyrimidine-4,6-diamine?
5-isocyano-4-N,6-N-dimethylpyrimidine-4,6-diamine has a molecular weight of 163.18 g/mol, XLogP of 1.11, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-isocyano-4-N,6-N-dimethylpyrimidine-4,6-diamine is sourced from PubChem (CID 123911501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).