C10H19F3N2O — CID 123911581
1-[(2R)-3,3,3-trifluoro-2-methoxypropyl]cyclohexane-1,4-diamine (PubChem CID 123911581) has the molecular formula C10H19F3N2O and a molecular weight of 240.27 g/mol. Its IUPAC name is 1-[(2R)-3,3,3-trifluoro-2-methoxypropyl]cyclohexane-1,4-diamine.
| Compound Name | 1-[(2R)-3,3,3-trifluoro-2-methoxypropyl]cyclohexane-1,4-diamine |
|---|---|
| PubChem CID | 123911581 |
| Molecular Formula | C10H19F3N2O |
| Molecular Weight | 240.27 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 1-[(2R)-3,3,3-trifluoro-2-methoxypropyl]cyclohexane-1,4-diamine |
| SMILES | CO[C@H](CC1(N)CCC(N)CC1)C(F)(F)F |
| InChI | InChI=1S/C10H19F3N2O/c1-16-8(10(11,12)13)6-9(15)4-2-7(14)3-5-9/h7-8H,2-6,14-15H2,1H3/t7?,8-,9?/m1/s1 |
| InChIKey | IRWIAXLUHJGMJC-QJAFJHJLSA-N |
| XLogP | 1.55 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.27 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |