C9H15FO — CID 123911803
4-fluoro-2-methyl-3-propan-2-yloxypenta-1,3-diene (PubChem CID 123911803) has the molecular formula C9H15FO and a molecular weight of 158.22 g/mol. Its IUPAC name is 4-fluoro-2-methyl-3-propan-2-yloxypenta-1,3-diene.
| Compound Name | 4-fluoro-2-methyl-3-propan-2-yloxypenta-1,3-diene |
|---|---|
| PubChem CID | 123911803 |
| Molecular Formula | C9H15FO |
| Molecular Weight | 158.22 g/mol |
| Exact Mass | 158.11 |
| IUPAC Name | 4-fluoro-2-methyl-3-propan-2-yloxypenta-1,3-diene |
| SMILES | C=C(C)C(OC(C)C)=C(C)F |
| InChI | InChI=1S/C9H15FO/c1-6(2)9(8(5)10)11-7(3)4/h7H,1H2,2-5H3 |
| InChIKey | ZZUBHWJWYUXHNK-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.22 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|