About 2-[[3-(dicyanomethyl)-5,5-dimethylcyclohex-2-en-1-ylidene]amino]ethanesulfonic acid
2-[[3-(dicyanomethyl)-5,5-dimethylcyclohex-2-en-1-ylidene]amino]ethanesulfonic acid (PubChem CID 123912636) has the molecular formula C13H17N3O3S
and a molecular weight of 295.36 g/mol. Its IUPAC name is 2-[[3-(dicyanomethyl)-5,5-dimethylcyclohex-2-en-1-ylidene]amino]ethanesulfonic acid.
Molecular Properties
| Compound Name | 2-[[3-(dicyanomethyl)-5,5-dimethylcyclohex-2-en-1-ylidene]amino]ethanesulfonic acid |
| PubChem CID | 123912636 |
| Molecular Formula | C13H17N3O3S |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | 2-[[3-(dicyanomethyl)-5,5-dimethylcyclohex-2-en-1-ylidene]amino]ethanesulfonic acid |
| SMILES | CC1(C)CC(C(C#N)C#N)=C/C(=N\CCS(=O)(=O)O)C1 |
| InChI | InChI=1S/C13H17N3O3S/c1-13(2)6-10(11(8-14)9-15)5-12(7-13)16-3-4-20(17,18)19/h5,11H,3-4,6-7H2,1-2H3,(H,17,18,19)/b16-12+ |
| InChIKey | QLQVTKUTKKXHQI-FOWTUZBSSA-N |
| XLogP | 1.72 |
| TPSA | 114.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[[3-(dicyanomethyl)-5,5-dimethylcyclohex-2-en-1-ylidene]amino]ethanesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[3-(dicyanomethyl)-5,5-dimethylcyclohex-2-en-1-ylidene]amino]ethanesulfonic acid?
The IUPAC name of 2-[[3-(dicyanomethyl)-5,5-dimethylcyclohex-2-en-1-ylidene]amino]ethanesulfonic acid (CID 123912636) is 2-[[3-(dicyanomethyl)-5,5-dimethylcyclohex-2-en-1-ylidene]amino]ethanesulfonic acid.
What is the SMILES notation for 2-[[3-(dicyanomethyl)-5,5-dimethylcyclohex-2-en-1-ylidene]amino]ethanesulfonic acid?
The canonical SMILES for 2-[[3-(dicyanomethyl)-5,5-dimethylcyclohex-2-en-1-ylidene]amino]ethanesulfonic acid is CC1(C)CC(C(C#N)C#N)=C/C(=N\CCS(=O)(=O)O)C1.
What is the InChIKey of 2-[[3-(dicyanomethyl)-5,5-dimethylcyclohex-2-en-1-ylidene]amino]ethanesulfonic acid?
The InChIKey is QLQVTKUTKKXHQI-FOWTUZBSSA-N. The full InChI is InChI=1S/C13H17N3O3S/c1-13(2)6-10(11(8-14)9-15)5-12(7-13)16-3-4-20(17,18)19/h5,11H,3-4,6-7H2,1-2H3,(H,17,18,19)/b16-12+.
What are the key properties of 2-[[3-(dicyanomethyl)-5,5-dimethylcyclohex-2-en-1-ylidene]amino]ethanesulfonic acid?
2-[[3-(dicyanomethyl)-5,5-dimethylcyclohex-2-en-1-ylidene]amino]ethanesulfonic acid has a molecular weight of 295.36 g/mol, XLogP of 1.72, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[3-(dicyanomethyl)-5,5-dimethylcyclohex-2-en-1-ylidene]amino]ethanesulfonic acid is sourced from PubChem (CID 123912636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).