C42H68F3NO2 — CID 123913086
1-[3-[6-(1-aminohexan-2-yl)-3-methylidene-4,5,6,7,8,8a-hexahydro-3aH-azulen-1-yl]-4-methylcyclohexyl]-4-[4-(oxepan-4-ylmethyl)-3-(trifluoromethyl)cyclohexyl]but-2-en-1-ol (PubChem CID 123913086) has the molecular formula C42H68F3NO2 and a molecular weight of 676.00 g/mol. Its IUPAC name is 1-[3-[6-(1-aminohexan-2-yl)-3-methylidene-4,5,6,7,8,8a-hexahydro-3aH-azulen-1-yl]-4-methylcyclohexyl]-4-[4-(oxepan-4-ylmethyl)-3-(trifluoromethyl)cyclohexyl]but-2-en-1-ol.
| Compound Name | 1-[3-[6-(1-aminohexan-2-yl)-3-methylidene-4,5,6,7,8,8a-hexahydro-3aH-azulen-1-yl]-4-methylcyclohexyl]-4-[4-(oxepan-4-ylmethyl)-3-(trifluoromethyl)cyclohexyl]but-2-en-1-ol |
|---|---|
| PubChem CID | 123913086 |
| Molecular Formula | C42H68F3NO2 |
| Molecular Weight | 676.00 g/mol |
| Exact Mass | 675.52 |
| IUPAC Name | 1-[3-[6-(1-aminohexan-2-yl)-3-methylidene-4,5,6,7,8,8a-hexahydro-3aH-azulen-1-yl]-4-methylcyclohexyl]-4-[4-(oxepan-4-ylmethyl)-3-(trifluoromethyl)cyclohexyl]but-2-en-1-ol |
| SMILES | C=C1C=C(C2CC(C(O)C=CCC3CCC(CC4CCCOCC4)C(C(F)(F)F)C3)CCC2C)C2CCC(C(CN)CCCC)CCC12 |
| InChI | InChI=1S/C42H68F3NO2/c1-4-5-10-35(27-46)32-16-18-36-29(3)23-39(37(36)19-17-32)38-26-34(14-12-28(38)2)41(47)11-6-8-30-13-15-33(40(25-30)42(43,44)45)24-31-9-7-21-48-22-20-31/h6,11,23,28,30-38,40-41,47H,3-5,7-10,12-22,24-27,46H2,1-2H3 |
| InChIKey | UWYOEIHWWKRIKO-UHFFFAOYSA-N |
| XLogP | 10.83 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.00 |
| LogP ≤ 5 | 10.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|