About N-[2-(2,6-dioxopiperidin-1-yl)ethyl]-N'-methyl-N-(methylideneamino)methanimidamide
N-[2-(2,6-dioxopiperidin-1-yl)ethyl]-N'-methyl-N-(methylideneamino)methanimidamide (PubChem CID 123913713) has the molecular formula C10H16N4O2
and a molecular weight of 224.26 g/mol. Its IUPAC name is N-[2-(2,6-dioxopiperidin-1-yl)ethyl]-N'-methyl-N-(methylideneamino)methanimidamide.
Molecular Properties
| Compound Name | N-[2-(2,6-dioxopiperidin-1-yl)ethyl]-N'-methyl-N-(methylideneamino)methanimidamide |
| PubChem CID | 123913713 |
| Molecular Formula | C10H16N4O2 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | N-[2-(2,6-dioxopiperidin-1-yl)ethyl]-N'-methyl-N-(methylideneamino)methanimidamide |
| SMILES | C=NN(/C=N/C)CCN1C(=O)CCCC1=O |
| InChI | InChI=1S/C10H16N4O2/c1-11-8-13(12-2)6-7-14-9(15)4-3-5-10(14)16/h8H,2-7H2,1H3/b11-8+ |
| InChIKey | MRNCUZHRWNKRLR-DHZHZOJOSA-N |
| XLogP | 0.10 |
| TPSA | 65.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(2,6-dioxopiperidin-1-yl)ethyl]-N'-methyl-N-(methylideneamino)methanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(2,6-dioxopiperidin-1-yl)ethyl]-N'-methyl-N-(methylideneamino)methanimidamide?
The IUPAC name of N-[2-(2,6-dioxopiperidin-1-yl)ethyl]-N'-methyl-N-(methylideneamino)methanimidamide (CID 123913713) is N-[2-(2,6-dioxopiperidin-1-yl)ethyl]-N'-methyl-N-(methylideneamino)methanimidamide.
What is the SMILES notation for N-[2-(2,6-dioxopiperidin-1-yl)ethyl]-N'-methyl-N-(methylideneamino)methanimidamide?
The canonical SMILES for N-[2-(2,6-dioxopiperidin-1-yl)ethyl]-N'-methyl-N-(methylideneamino)methanimidamide is C=NN(/C=N/C)CCN1C(=O)CCCC1=O.
What is the InChIKey of N-[2-(2,6-dioxopiperidin-1-yl)ethyl]-N'-methyl-N-(methylideneamino)methanimidamide?
The InChIKey is MRNCUZHRWNKRLR-DHZHZOJOSA-N. The full InChI is InChI=1S/C10H16N4O2/c1-11-8-13(12-2)6-7-14-9(15)4-3-5-10(14)16/h8H,2-7H2,1H3/b11-8+.
What are the key properties of N-[2-(2,6-dioxopiperidin-1-yl)ethyl]-N'-methyl-N-(methylideneamino)methanimidamide?
N-[2-(2,6-dioxopiperidin-1-yl)ethyl]-N'-methyl-N-(methylideneamino)methanimidamide has a molecular weight of 224.26 g/mol, XLogP of 0.10, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(2,6-dioxopiperidin-1-yl)ethyl]-N'-methyl-N-(methylideneamino)methanimidamide is sourced from PubChem (CID 123913713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).