C3H6N4O2 — CID 123914684
1-amino-4-methyl-1,2,4-triazolidine-3,5-dione (PubChem CID 123914684) has the molecular formula C3H6N4O2 and a molecular weight of 130.11 g/mol. Its IUPAC name is 1-amino-4-methyl-1,2,4-triazolidine-3,5-dione.
| Compound Name | 1-amino-4-methyl-1,2,4-triazolidine-3,5-dione |
|---|---|
| PubChem CID | 123914684 |
| Molecular Formula | C3H6N4O2 |
| Molecular Weight | 130.11 g/mol |
| Exact Mass | 130.05 |
| IUPAC Name | 1-amino-4-methyl-1,2,4-triazolidine-3,5-dione |
| SMILES | Cn1c(=O)[nH]n(N)c1=O |
| InChI | InChI=1S/C3H6N4O2/c1-6-2(8)5-7(4)3(6)9/h4H2,1H3,(H,5,8) |
| InChIKey | KCHUFECPIPBGPY-UHFFFAOYSA-N |
| XLogP | -2.41 |
| TPSA | 85.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.11 |
| LogP ≤ 5 | -2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |