About 3,5-dimethoxy-2-(methoxymethyl)-4-methylidenehepta-1,6-diene
3,5-dimethoxy-2-(methoxymethyl)-4-methylidenehepta-1,6-diene (PubChem CID 123915006) has the molecular formula C12H20O3
and a molecular weight of 212.29 g/mol. Its IUPAC name is 3,5-dimethoxy-2-(methoxymethyl)-4-methylidenehepta-1,6-diene.
Molecular Properties
| Compound Name | 3,5-dimethoxy-2-(methoxymethyl)-4-methylidenehepta-1,6-diene |
| PubChem CID | 123915006 |
| Molecular Formula | C12H20O3 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | 3,5-dimethoxy-2-(methoxymethyl)-4-methylidenehepta-1,6-diene |
| SMILES | C=CC(OC)C(=C)C(OC)C(=C)COC |
| InChI | InChI=1S/C12H20O3/c1-7-11(14-5)10(3)12(15-6)9(2)8-13-4/h7,11-12H,1-3,8H2,4-6H3 |
| InChIKey | HTHKNHXSXIZICY-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3,5-dimethoxy-2-(methoxymethyl)-4-methylidenehepta-1,6-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dimethoxy-2-(methoxymethyl)-4-methylidenehepta-1,6-diene?
The IUPAC name of 3,5-dimethoxy-2-(methoxymethyl)-4-methylidenehepta-1,6-diene (CID 123915006) is 3,5-dimethoxy-2-(methoxymethyl)-4-methylidenehepta-1,6-diene.
What is the SMILES notation for 3,5-dimethoxy-2-(methoxymethyl)-4-methylidenehepta-1,6-diene?
The canonical SMILES for 3,5-dimethoxy-2-(methoxymethyl)-4-methylidenehepta-1,6-diene is C=CC(OC)C(=C)C(OC)C(=C)COC.
What is the InChIKey of 3,5-dimethoxy-2-(methoxymethyl)-4-methylidenehepta-1,6-diene?
The InChIKey is HTHKNHXSXIZICY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O3/c1-7-11(14-5)10(3)12(15-6)9(2)8-13-4/h7,11-12H,1-3,8H2,4-6H3.
What are the key properties of 3,5-dimethoxy-2-(methoxymethyl)-4-methylidenehepta-1,6-diene?
3,5-dimethoxy-2-(methoxymethyl)-4-methylidenehepta-1,6-diene has a molecular weight of 212.29 g/mol, XLogP of 1.96, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethoxy-2-(methoxymethyl)-4-methylidenehepta-1,6-diene is sourced from PubChem (CID 123915006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).