C14H29N2O3+ — CID 123915113
2-(1,3-dihydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)ethyl-(2-hydroxyethyl)-dimethylazanium (PubChem CID 123915113) has the molecular formula C14H29N2O3+ and a molecular weight of 273.40 g/mol. Its IUPAC name is 2-(1,3-dihydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)ethyl-(2-hydroxyethyl)-dimethylazanium.
| Compound Name | 2-(1,3-dihydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)ethyl-(2-hydroxyethyl)-dimethylazanium |
|---|---|
| PubChem CID | 123915113 |
| Molecular Formula | C14H29N2O3+ |
| Molecular Weight | 273.40 g/mol |
| Exact Mass | 273.22 |
| IUPAC Name | 2-(1,3-dihydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)ethyl-(2-hydroxyethyl)-dimethylazanium |
| SMILES | C[N+](C)(CCO)CCN1C(O)C2CCCCC2C1O |
| InChI | InChI=1S/C14H29N2O3/c1-16(2,9-10-17)8-7-15-13(18)11-5-3-4-6-12(11)14(15)19/h11-14,17-19H,3-10H2,1-2H3/q+1 |
| InChIKey | GRAPYXVOMMTPRU-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.40 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|