About 3-(1,2-dimethylcyclopentyl)-2-(2-ethyl-6-fluoro-4-methylcycloheptyl)azetidine
3-(1,2-dimethylcyclopentyl)-2-(2-ethyl-6-fluoro-4-methylcycloheptyl)azetidine (PubChem CID 123915199) has the molecular formula C20H36FN
and a molecular weight of 309.51 g/mol. Its IUPAC name is 3-(1,2-dimethylcyclopentyl)-2-(2-ethyl-6-fluoro-4-methylcycloheptyl)azetidine.
Molecular Properties
| Compound Name | 3-(1,2-dimethylcyclopentyl)-2-(2-ethyl-6-fluoro-4-methylcycloheptyl)azetidine |
| PubChem CID | 123915199 |
| Molecular Formula | C20H36FN |
| Molecular Weight | 309.51 g/mol |
| Exact Mass | 309.28 |
| IUPAC Name | 3-(1,2-dimethylcyclopentyl)-2-(2-ethyl-6-fluoro-4-methylcycloheptyl)azetidine |
| SMILES | CCC1CC(C)CC(F)CC1C1NCC1C1(C)CCCC1C |
| InChI | InChI=1S/C20H36FN/c1-5-15-9-13(2)10-16(21)11-17(15)19-18(12-22-19)20(4)8-6-7-14(20)3/h13-19,22H,5-12H2,1-4H3 |
| InChIKey | SUOKORKITCPEGP-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 309.51 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-(1,2-dimethylcyclopentyl)-2-(2-ethyl-6-fluoro-4-methylcycloheptyl)azetidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,2-dimethylcyclopentyl)-2-(2-ethyl-6-fluoro-4-methylcycloheptyl)azetidine?
The IUPAC name of 3-(1,2-dimethylcyclopentyl)-2-(2-ethyl-6-fluoro-4-methylcycloheptyl)azetidine (CID 123915199) is 3-(1,2-dimethylcyclopentyl)-2-(2-ethyl-6-fluoro-4-methylcycloheptyl)azetidine.
What is the SMILES notation for 3-(1,2-dimethylcyclopentyl)-2-(2-ethyl-6-fluoro-4-methylcycloheptyl)azetidine?
The canonical SMILES for 3-(1,2-dimethylcyclopentyl)-2-(2-ethyl-6-fluoro-4-methylcycloheptyl)azetidine is CCC1CC(C)CC(F)CC1C1NCC1C1(C)CCCC1C.
What is the InChIKey of 3-(1,2-dimethylcyclopentyl)-2-(2-ethyl-6-fluoro-4-methylcycloheptyl)azetidine?
The InChIKey is SUOKORKITCPEGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H36FN/c1-5-15-9-13(2)10-16(21)11-17(15)19-18(12-22-19)20(4)8-6-7-14(20)3/h13-19,22H,5-12H2,1-4H3.
What are the key properties of 3-(1,2-dimethylcyclopentyl)-2-(2-ethyl-6-fluoro-4-methylcycloheptyl)azetidine?
3-(1,2-dimethylcyclopentyl)-2-(2-ethyl-6-fluoro-4-methylcycloheptyl)azetidine has a molecular weight of 309.51 g/mol, XLogP of 5.20, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,2-dimethylcyclopentyl)-2-(2-ethyl-6-fluoro-4-methylcycloheptyl)azetidine is sourced from PubChem (CID 123915199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).