C23H38F2N2O2 — CID 123915270
2-fluoro-N-[2-(2-fluoronon-2-enoylamino)cyclopentyl]non-2-enamide (PubChem CID 123915270) has the molecular formula C23H38F2N2O2 and a molecular weight of 412.57 g/mol. Its IUPAC name is 2-fluoro-N-[2-(2-fluoronon-2-enoylamino)cyclopentyl]non-2-enamide.
| Compound Name | 2-fluoro-N-[2-(2-fluoronon-2-enoylamino)cyclopentyl]non-2-enamide |
|---|---|
| PubChem CID | 123915270 |
| Molecular Formula | C23H38F2N2O2 |
| Molecular Weight | 412.57 g/mol |
| Exact Mass | 412.29 |
| IUPAC Name | 2-fluoro-N-[2-(2-fluoronon-2-enoylamino)cyclopentyl]non-2-enamide |
| SMILES | CCCCCCC=C(F)C(=O)NC1CCCC1NC(=O)C(F)=CCCCCCC |
| InChI | InChI=1S/C23H38F2N2O2/c1-3-5-7-9-11-14-18(24)22(28)26-20-16-13-17-21(20)27-23(29)19(25)15-12-10-8-6-4-2/h14-15,20-21H,3-13,16-17H2,1-2H3,(H,26,28)(H,27,29) |
| InChIKey | NPLBLSYLFBYDDM-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.57 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|