About N-[(1E)-3-methyl-2-prop-1-en-2-ylsulfanylbuta-1,3-dienyl]ethanimine
N-[(1E)-3-methyl-2-prop-1-en-2-ylsulfanylbuta-1,3-dienyl]ethanimine (PubChem CID 123915297) has the molecular formula C10H15NS
and a molecular weight of 181.30 g/mol. Its IUPAC name is N-[(1E)-3-methyl-2-prop-1-en-2-ylsulfanylbuta-1,3-dienyl]ethanimine.
Molecular Properties
| Compound Name | N-[(1E)-3-methyl-2-prop-1-en-2-ylsulfanylbuta-1,3-dienyl]ethanimine |
| PubChem CID | 123915297 |
| Molecular Formula | C10H15NS |
| Molecular Weight | 181.30 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | N-[(1E)-3-methyl-2-prop-1-en-2-ylsulfanylbuta-1,3-dienyl]ethanimine |
| SMILES | C=C(C)S/C(=C/N=C/C)C(=C)C |
| InChI | InChI=1S/C10H15NS/c1-6-11-7-10(8(2)3)12-9(4)5/h6-7H,2,4H2,1,3,5H3/b10-7+,11-6+ |
| InChIKey | ZEDIHEYSIFJCCM-NXAIOARDSA-N |
| XLogP | 3.76 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.30 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(1E)-3-methyl-2-prop-1-en-2-ylsulfanylbuta-1,3-dienyl]ethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1E)-3-methyl-2-prop-1-en-2-ylsulfanylbuta-1,3-dienyl]ethanimine?
The IUPAC name of N-[(1E)-3-methyl-2-prop-1-en-2-ylsulfanylbuta-1,3-dienyl]ethanimine (CID 123915297) is N-[(1E)-3-methyl-2-prop-1-en-2-ylsulfanylbuta-1,3-dienyl]ethanimine.
What is the SMILES notation for N-[(1E)-3-methyl-2-prop-1-en-2-ylsulfanylbuta-1,3-dienyl]ethanimine?
The canonical SMILES for N-[(1E)-3-methyl-2-prop-1-en-2-ylsulfanylbuta-1,3-dienyl]ethanimine is C=C(C)S/C(=C/N=C/C)C(=C)C.
What is the InChIKey of N-[(1E)-3-methyl-2-prop-1-en-2-ylsulfanylbuta-1,3-dienyl]ethanimine?
The InChIKey is ZEDIHEYSIFJCCM-NXAIOARDSA-N. The full InChI is InChI=1S/C10H15NS/c1-6-11-7-10(8(2)3)12-9(4)5/h6-7H,2,4H2,1,3,5H3/b10-7+,11-6+.
What are the key properties of N-[(1E)-3-methyl-2-prop-1-en-2-ylsulfanylbuta-1,3-dienyl]ethanimine?
N-[(1E)-3-methyl-2-prop-1-en-2-ylsulfanylbuta-1,3-dienyl]ethanimine has a molecular weight of 181.30 g/mol, XLogP of 3.76, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1E)-3-methyl-2-prop-1-en-2-ylsulfanylbuta-1,3-dienyl]ethanimine is sourced from PubChem (CID 123915297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).