C21H17F2N3O2 — CID 123915427
N-[3-fluoro-4-[[2-(2-iminoethyl)-3-pyridinyl]oxy]phenyl]-2-(4-fluorophenyl)acetamide (PubChem CID 123915427) has the molecular formula C21H17F2N3O2 and a molecular weight of 381.38 g/mol. Its IUPAC name is N-[3-fluoro-4-[[2-(2-iminoethyl)-3-pyridinyl]oxy]phenyl]-2-(4-fluorophenyl)acetamide.
| Compound Name | N-[3-fluoro-4-[[2-(2-iminoethyl)-3-pyridinyl]oxy]phenyl]-2-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 123915427 |
| Molecular Formula | C21H17F2N3O2 |
| Molecular Weight | 381.38 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | N-[3-fluoro-4-[[2-(2-iminoethyl)-3-pyridinyl]oxy]phenyl]-2-(4-fluorophenyl)acetamide |
| SMILES | [H]/N=C/Cc1ncccc1Oc1ccc(NC(=O)Cc2ccc(F)cc2)cc1F |
| InChI | InChI=1S/C21H17F2N3O2/c22-15-5-3-14(4-6-15)12-21(27)26-16-7-8-19(17(23)13-16)28-20-2-1-11-25-18(20)9-10-24/h1-8,10-11,13,24H,9,12H2,(H,26,27)/b24-10+ |
| InChIKey | NAYALCOFCWDGAE-YSURURNPSA-N |
| XLogP | 4.53 |
| TPSA | 75.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.38 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|